Blonanserin

Blonanserin is a 4-phenyl-2-(1-piperazinyl) pyridine that acts as an antagonist at dopamine D2, D3, and serotonin 5-HT2A receptors (Kis = 0.14, 0.49, and 0.81 nM, respectively). It binds to 5-HT6 with a Ki value of 11.7 nM and demonstrates relatively low affinity for 5-HT2C (Ki = 26.4 nM), adrenergic alpha1 (Ki = 26.7 nM), histamine H1 (Ki = 765 nM), and muscarinic M1 receptors (Ki = 100 nM). Blonanserin was developed in Japan as a novel antipsychotic that displays 20- and 94-fold higher affinity for D2 receptors compared to haloperidol (Cay-12014) and risperidone (Cay-13629), respectively.Formal Name: 2-(4-ethyl-1-piperazinyl)-4-(4-fluorophenyl)-5,6,7,8,9,10-hexahydro-cycloocta[b]pyridine. CAS Number: 132810-10-7. Synonyms: AD5423, Lonasen. Molecular Formula: C23H30FN3. Formula Weight: 367.5. Purity: >98%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 15 mg/ml, Ethanol: 10 mg/ml. lambdamax: 236, 315 nm. SMILES: CCN1CCN(C2=NC(CCCCCC3)=C3C(C4=CC=C(F)C=C4)=C2)CC1. InChi Code: InChI=1S/C23H30FN3/c1-2-26-13-15-27(16-14-26)23-17-21(18-9-11-19(24)12-10-18)20-7-5-3-4-6-8-22(20)25-23/h9-12,17H,2-8,13-16H2,1H3. InChi Key: XVGOZDAJGBALKS-UHFFFAOYSA-N.